diphenyl(2-trichlorosilylethyl)phosphane structure
|
Common Name | diphenyl(2-trichlorosilylethyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 4145-77-1 | Molecular Weight | 347.67900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14Cl3PSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diphenyl(2-trichlorosilylethyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14Cl3PSi |
|---|---|
| Molecular Weight | 347.67900 |
| Exact Mass | 345.96700 |
| PSA | 13.59000 |
| LogP | 4.77460 |
| InChIKey | XRUDEKBFZZCMAP-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CCP(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~85%
diphenyl(2-tric... CAS#:4145-77-1 |
| Literature: Ruffieux, Vincent; Schmid, Guenter; Braunstein, Pierre; Rose, Jacky Chemistry - A European Journal, 1997 , vol. 3, # 6 p. 900 - 903 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphine,diphenyl[2-(trichlorosilyl)ethyl] |