5,5'-azobis[1-phenyl-1H-tetrazole] structure
|
Common Name | 5,5'-azobis[1-phenyl-1H-tetrazole] | ||
|---|---|---|---|---|
| CAS Number | 41463-67-6 | Molecular Weight | 318.29600 | |
| Density | 1.56g/cm3 | Boiling Point | 565.1ºC at 760mmHg | |
| Molecular Formula | C14H10N10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.5ºC | |
| Name | (E)-bis(1-phenyltetrazol-5-yl)diazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 565.1ºC at 760mmHg |
| Molecular Formula | C14H10N10 |
| Molecular Weight | 318.29600 |
| Flash Point | 295.5ºC |
| Exact Mass | 318.10900 |
| PSA | 111.92000 |
| LogP | 2.05340 |
| Index of Refraction | 1.829 |
| InChIKey | RFDMWAAVQQFVFK-UHFFFAOYSA-N |
| SMILES | c1ccc(-n2nnnc2N=Nc2nnnn2-c2ccccc2)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
5,5'-azobis[1-p... CAS#:41463-67-6 |
| Literature: Stolle et al. Journal fuer Praktische Chemie (Leipzig), 1932 , vol. <2>134, p. 282,297 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 255-383-9 |
| 1,1'-diphenyl-1H,1'H-[5,5']azotetrazole |
| 1H-Tetrazole,5,5'-azobis(1-phenyl |
| 5,5'-Azobis(1-phenyl-1H-tetrazole) |
| 1H-Tetrazole,5,5'-(1,2-diazenediyl)bis(1-phenyl |