2,2',5,6'-PCB structure
|
Common Name | 2,2',5,6'-PCB | ||
|---|---|---|---|---|
| CAS Number | 41464-41-9 | Molecular Weight | 291.988 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 330.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Cl4 | Melting Point | 104°C | |
| MSDS | N/A | Flash Point | 151.3±23.9 °C | |
| Name | 2,2',5,6'-Tetrachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.6±37.0 °C at 760 mmHg |
| Melting Point | 104°C |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.988 |
| Flash Point | 151.3±23.9 °C |
| Exact Mass | 289.922363 |
| LogP | 5.92 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | SFTUSTXGTCCSHX-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(-c2c(Cl)cccc2Cl)c1 |
| Storage condition | -20°C |
| HS Code | 2903999090 |
|---|
|
~%
2,2',5,6'-PCB CAS#:41464-41-9 |
| Literature: Bolgar; et al. Chemosphere, 1995 , vol. 31, # 2 p. 2687 - 2705 |
|
~%
2,2',5,6'-PCB CAS#:41464-41-9 |
| Literature: Sundstroem,G. Acta Chemica Scandinavica (1947-1973), 1973 , vol. 27, p. 600 - 604 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Biphenyl, 2,2',5,6'-tetrachloro- |
| 1,3-dichloro-2-(2,5-dichlorophenyl)benzene |
| 2,2',5,6'-PCB |
| 2,2',5,6'-Tetrachlorobiphenyl |
| 2,2',5,6'-Tetrachloro-1,1'-biphenyl |