N,N-bis(trimethylsilyl)aniline
N,N-bis(trimethylsilyl)aniline structure
|
Common Name | N,N-bis(trimethylsilyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 4147-89-1 | Molecular Weight | 237.48900 | |
| Density | 0.896g/cm3 | Boiling Point | 248.3ºC at 760 mmHg | |
| Molecular Formula | C12H23NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104ºC | |
Summary: N,N-bis(trimethylsilyl)aniline (CAS: 4147-89-1), molecular formula C12H23NSi2, molecular weight 237.48900, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-bis(trimethylsilyl)aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.896g/cm3 |
|---|---|
| Boiling Point | 248.3ºC at 760 mmHg |
| Molecular Formula | C12H23NSi2 |
| Molecular Weight | 237.48900 |
| Flash Point | 104ºC |
| Exact Mass | 237.13700 |
| PSA | 3.24000 |
| LogP | 4.16280 |
| Index of Refraction | 1.489 |
| InChIKey | UUBHRQZKROMHOC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N(c1ccccc1)[Si](C)(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2931900090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N,N-bis(trimethylsilyl)aniline? |
| A: LogP of N,N-bis(trimethylsilyl)aniline is 4.16280. |
| Q: What is the molecular formula of N,N-bis(trimethylsilyl)aniline? |
| A: Molecular formula of N,N-bis(trimethylsilyl)aniline is C12H23NSi2. |
| Q: What is the CAS number of N,N-bis(trimethylsilyl)aniline? |
| A: CAS number of N,N-bis(trimethylsilyl)aniline is 4147-89-1. |
| Q: What is the boiling point of N,N-bis(trimethylsilyl)aniline? |
| A: Boiling point of N,N-bis(trimethylsilyl)aniline is 248.3ºC at 760 mmHg. |
| Q: What is the InChIKey of N,N-bis(trimethylsilyl)aniline? |
| A: InChIKey of N,N-bis(trimethylsilyl)aniline is UUBHRQZKROMHOC-UHFFFAOYSA-N. |
| Q: What is the English name of N,N-bis(trimethylsilyl)aniline? |
| A: The English name of N,N-bis(trimethylsilyl)aniline is N,N-bis(trimethylsilyl)aniline. |
| Q: What is the polar surface area (PSA) of N,N-bis(trimethylsilyl)aniline? |
| A: Polar surface area (PSA) of N,N-bis(trimethylsilyl)aniline is 3.24000. |
| Q: What is the molecular weight of N,N-bis(trimethylsilyl)aniline? |
| A: Molecular weight of N,N-bis(trimethylsilyl)aniline is 237.48900. |
| Q: What is the Chinese name of 4147-89-1? |
| A: Chinese name of 4147-89-1 is 4147-89-1. |
| Q: What is the SMILES notation of N,N-bis(trimethylsilyl)aniline? |
| A: SMILES notation of N,N-bis(trimethylsilyl)aniline is C[Si](C)(C)N(c1ccccc1)[Si](C)(C)C. |