[[chloro(trimethylsilyl)amino]-dimethylsilyl]methane structure
|
Common Name | [[chloro(trimethylsilyl)amino]-dimethylsilyl]methane | ||
|---|---|---|---|---|
| CAS Number | 4148-01-0 | Molecular Weight | 195.83800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H18ClNSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[chloro(trimethylsilyl)amino]-dimethylsilyl]methane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H18ClNSi2 |
|---|---|
| Molecular Weight | 195.83800 |
| Exact Mass | 195.06700 |
| PSA | 3.24000 |
| LogP | 3.11200 |
| InChIKey | QOQJBDOYNOQRTD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N(Cl)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~%
[[chloro(trimet... CAS#:4148-01-0 |
| Literature: Blaschette,A.; Safari,H. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1970 , vol. 25b, p. 319 - 320 |
|
~%
[[chloro(trimet... CAS#:4148-01-0 |
| Literature: Rinne, D.; Blaschette, A. Zeitschrift fuer Naturforschung, 1975 , vol. 30b, p. 323 - 326 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silanamine,N-chloro-1,1,1-trimethyl-N-(trimethylsilyl) |
| N-Chlor-hexamethyl-disilazan |
| N,N-bis(trimethylsilyl)-N-chloroamine |
| N-Chlor-bis-(trimethylsilyl)amin |
| N-chlorohexamethyldisilazane |