1-Prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonyl-benzene
Modify Date: 2026-07-18 11:33:17
1-Prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonyl-benzene structure
|
Common Name | 1-Prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 41481-63-4 | Molecular Weight | 330.39800 | |
| Density | 1.171 g/cm3 | Boiling Point | 500.7ºC at 760 mmHg | |
| Molecular Formula | C18H18O4S | Melting Point | 143-145ºC | |
| MSDS | N/A | Flash Point | 256.6ºC | |
| Name | 1-prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.171 g/cm3 |
|---|---|
| Boiling Point | 500.7ºC at 760 mmHg |
| Melting Point | 143-145ºC |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.39800 |
| Flash Point | 256.6ºC |
| Exact Mass | 330.09300 |
| PSA | 60.98000 |
| LogP | 4.72980 |
| Index of Refraction | 1.559 |
| InChIKey | JUNVYDTYJZSTKY-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(S(=O)(=O)c2ccc(OCC=C)cc2)cc1 |
| Storage condition | 2-8℃ |
| HS Code | 2909309090 |
|---|
|
~%
1-Prop-2-enoxy-... CAS#:41481-63-4 |
| Literature: Pews, R. Garth Patent: US2005/90673 A1, 2005 ; Location in patent: Page/Page column 4 ; |
|
~%
1-Prop-2-enoxy-... CAS#:41481-63-4 |
| Literature: Nippon Kayaku Kabushiki Kaisha Patent: US4596997 A1, 1986 ; |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:41481-66-7| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 5, Current Page 1 of 1
1
| 4-alloxyphenyl sulfone |
| 4,4'-Diallyloxydiphenylsulfon |
| 1,1'-SULFONYLBIS[4-(2-PROPENYL)OXY-BENZENE] |
| 1-Prop-2-enoxy-4-(4-prop-2-enoxyphenyl)sulfonyl-benzene |
| 4,4'-diallyloxydiphenyl sulfone |
| MFCD00506306 |
| BIS(4-ALLYLOXYPHENYL)SULFONE |
| 1,1'-sulfonylbis[4-(prop-2-en-1-yloxy)benzol] |