mercury,triethylsilicon
mercury,triethylsilicon structure
|
Common Name | mercury,triethylsilicon | ||
|---|---|---|---|---|
| CAS Number | 4149-29-5 | Molecular Weight | 431.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H30HgSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Mercury, triethylsilicon, also known as 三乙基硅汞, has a CAS number of 4149-29-5, with a molecular formula of C12H30HgSi2 and a molecular weight of 431.12800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | mercury,triethylsilicon |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H30HgSi2 |
|---|---|
| Molecular Weight | 431.12800 |
| Exact Mass | 432.15900 |
| LogP | 5.07930 |
| InChIKey | NDWMIZFKONYJQX-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)CC.CC[Si](CC)CC.[Hg] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:20098-55-9
CAS#:13810-04-3
CAS#:73303-68-1
CAS#:86808-02-8
CAS#:55453-13-9
CAS#:59344-12-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Bis-(triethylsilyl)-quecksilber |
| bis(triethylsilyl)mercury |
| Bis(trimethylsilyl)mercury |
| Mercury,bis(triethylsilyl) |
| Bis-triaethylsilyl-quecksilber |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of mercury,triethylsilicon? |
| A: Related downstream products(CAS) of mercury,triethylsilicon: 20098-55-9;13810-04-3;73303-68-1;86808-02-8;55453-13-9;59344-12-6. |
| Q: What is the InChIKey of mercury,triethylsilicon? |
| A: InChIKey of mercury,triethylsilicon is NDWMIZFKONYJQX-UHFFFAOYSA-N. |
| Q: What is the CAS number of mercury,triethylsilicon? |
| A: CAS number of mercury,triethylsilicon is 4149-29-5. |
| Q: What is the LogP of mercury,triethylsilicon? |
| A: LogP of mercury,triethylsilicon is 5.07930. |
| Q: What is the molecular formula of mercury,triethylsilicon? |
| A: Molecular formula of mercury,triethylsilicon is C12H30HgSi2. |
| Q: What English synonyms does mercury,triethylsilicon have? |
| A: English synonyms of mercury,triethylsilicon: Bis-(triethylsilyl)-quecksilber, bis(triethylsilyl)mercury, Bis(trimethylsilyl)mercury, Mercury,bis(triethylsilyl), Bis-triaethylsilyl-quecksilber. |
| Q: What is the molecular weight of mercury,triethylsilicon? |
| A: Molecular weight of mercury,triethylsilicon is 431.12800. |
| Q: What is the English name of mercury,triethylsilicon? |
| A: The English name of mercury,triethylsilicon is mercury,triethylsilicon. |
| Q: What is the SMILES notation of mercury,triethylsilicon? |
| A: SMILES notation of mercury,triethylsilicon is CC[Si](CC)CC.CC[Si](CC)CC.[Hg]. |
| Q: What is the Chinese name of 4149-29-5? |
| A: Chinese name of 4149-29-5 is 4149-29-5. |