Casopitant structure
|
Common Name | Casopitant | ||
|---|---|---|---|---|
| CAS Number | 414910-27-3 | Molecular Weight | 616.61300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H35F7N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CasopitantCasopitant (GW679769) is a potent, centrally-acting neurokinin 1 (NK1) receptor antagonist (pKi=9.48) with antidepressant and antiemetic activities. |
| Name | [14C]-Casopitant |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H35F7N4O2 |
|---|---|
| Molecular Weight | 616.61300 |
| Exact Mass | 616.26500 |
| PSA | 47.10000 |
| LogP | 6.46800 |
| InChIKey | XGGTZCKQRWXCHW-KAZGAHJFSA-N |
| SMILES | CC(=O)N1CCN(C2CCN(C(=O)N(C)C(C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(c3ccc(F)cc3C)C2)CC1 |
| Casopitant |