3-(dimethylamino)-1-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)propan-1-ol
Modify Date: 2025-08-22 12:47:06
3-(dimethylamino)-1-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)propan-1-ol structure
|
Common Name | 3-(dimethylamino)-1-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 4150-88-3 | Molecular Weight | 313.43400 | |
| Density | 1.053g/cm3 | Boiling Point | 458.2ºC at 760 mmHg | |
| Molecular Formula | C20H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | 3-(dimethylamino)-1-(4-methoxyphenyl)-2-methyl-1-(4-methylphenyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.053g/cm3 |
|---|---|
| Boiling Point | 458.2ºC at 760 mmHg |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.43400 |
| Flash Point | 230.9ºC |
| Exact Mass | 313.20400 |
| PSA | 32.70000 |
| LogP | 3.43720 |
| Index of Refraction | 1.551 |
| InChIKey | WLPOSYYUWKQTOG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)(c2ccc(C)cc2)C(C)CN(C)C)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Dimethylamino-1-<4-methoxy-phenyl>-2-methyl-1-<4-methyl-phenyl>-propan-1-ol |
| 1-Propanol,3-dimethylamino-1-p-methoxyphenyl-2-methyl-1-p-tolyl |