3-(dimethylamino)-2-methyl-1,1-bis(2-methylphenyl)propan-1-ol structure
|
Common Name | 3-(dimethylamino)-2-methyl-1,1-bis(2-methylphenyl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 4150-94-1 | Molecular Weight | 297.43400 | |
| Density | 1.025g/cm3 | Boiling Point | 441.4ºC at 760 mmHg | |
| Molecular Formula | C20H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.4ºC | |
| Name | 3-(dimethylamino)-2-methyl-1,1-bis(2-methylphenyl)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.025g/cm3 |
|---|---|
| Boiling Point | 441.4ºC at 760 mmHg |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.43400 |
| Flash Point | 170.4ºC |
| Exact Mass | 297.20900 |
| PSA | 23.47000 |
| LogP | 3.73700 |
| Index of Refraction | 1.555 |
| InChIKey | JCBHLVMZYWEPFD-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(O)(c1ccccc1C)C(C)CN(C)C |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Dimethylamino-2-methyl-1,1-bis-<2-methyl-phenyl>-propan-1-ol |
| 1-Propanol,3-dimethylamino-1,1-di-o-tolyl-2-methyl |