3-(dimethylamino)-1-(2-methylphenyl)-1-phenylpropan-1-ol
Modify Date: 2025-11-30 13:12:06
3-(dimethylamino)-1-(2-methylphenyl)-1-phenylpropan-1-ol structure
|
Common Name | 3-(dimethylamino)-1-(2-methylphenyl)-1-phenylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 4150-95-2 | Molecular Weight | 269.38100 | |
| Density | 1.049g/cm3 | Boiling Point | 418.2ºC at 760 mmHg | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.9ºC | |
| Name | 3-(dimethylamino)-1-(2-methylphenyl)-1-phenylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 418.2ºC at 760 mmHg |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.38100 |
| Flash Point | 159.9ºC |
| Exact Mass | 269.17800 |
| PSA | 23.47000 |
| LogP | 3.18260 |
| Index of Refraction | 1.565 |
| InChIKey | BMFVGTKWLFSPTM-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(O)(CCN(C)C)c1ccccc1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Dimethylamino-1-(2-methyl-phenyl)-1-phenyl-propan-1-ol |
| 1-Propanol,3-dimethylamino-1-phenyl-1-o-tolyl |
| 3-dimethylamino-1-phenyl-1-o-tolyl-propan-1-ol |