3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one
3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one structure
|
Common Name | 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 41501-68-2 | Molecular Weight | 215.07600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8Cl2O |
|---|---|
| Molecular Weight | 215.07600 |
| Exact Mass | 213.99500 |
| PSA | 17.07000 |
| LogP | 3.49670 |
| InChIKey | DXWSSQFFZRINDV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C=C(Cl)Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3,3-dichloro-1-... CAS#:41501-68-2 |
| Literature: Kamigata, Nobumasa; Udodaira, Kumiko; Yoshikawa, Manabu; Shimizu, Toshio Journal of Organometallic Chemistry, 1998 , vol. 552, # 1-2 p. 39 - 43 |
|
~%
3,3-dichloro-1-... CAS#:41501-68-2 |
| Literature: Atavin,A.S. et al. Zhurnal Organicheskoi Khimii, 1973 , vol. 9, p. 318 - 321,320 - 322 |
|
~61%
3,3-dichloro-1-... CAS#:41501-68-2 |
| Literature: Kamigata, Nobumasa; Udodaira, Kumiko; Yoshikawa, Manabu; Shimizu, Toshio Journal of Organometallic Chemistry, 1998 , vol. 552, # 1-2 p. 39 - 43 |
![trimethyl-[1-(4-methylphenyl)ethenoxy]silane structure](https://image.chemsrc.com/caspic/343/54731-27-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 1 | |
CAS#:41467-27-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3-dichloro-1-p-tolyl-propenone |
| 3,3-dichloro-1-(4-tolyl)-2-propen-1-one |
| 2-Propen-1-one,3,3-dichloro-1-(4-methylphenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: Related upstream materials(CAS) of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one: 56-23-5;54731-27-0;122-00-9;20618-08-0;108-88-3. |
| Q: What is the SMILES notation of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: SMILES notation of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is Cc1ccc(C(=O)C=C(Cl)Cl)cc1. |
| Q: What is the polar surface area (PSA) of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: Polar surface area (PSA) of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is 17.07000. |
| Q: What is the molecular weight of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: Molecular weight of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is 215.07600. |
| Q: What is the molecular formula of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: Molecular formula of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is C10H8Cl2O. |
| Q: What is the CAS number of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: CAS number of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is 41501-68-2. |
| Q: What is the English name of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: The English name of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one. |
| Q: What are the downstream products of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: Related downstream products(CAS) of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one: 41467-27-0. |
| Q: What is the Chinese name of 41501-68-2? |
| A: Chinese name of 41501-68-2 is 41501-68-2. |
| Q: What is the LogP of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one? |
| A: LogP of 3,3-dichloro-1-(4-methylphenyl)prop-2-en-1-one is 3.49670. |