Phosphonic acid,phenyl-, 1,4-butanediyl diethyl ester (9CI) structure
|
Common Name | Phosphonic acid,phenyl-, 1,4-butanediyl diethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 4151-23-9 | Molecular Weight | 426.38000 | |
| Density | 1.19g/cm3 | Boiling Point | 526.7ºC at 760 mmHg | |
| Molecular Formula | C20H28O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.3ºC | |
| Name | [ethoxy-[4-[ethoxy(phenyl)phosphoryl]oxybutoxy]phosphoryl]benzene |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 526.7ºC at 760 mmHg |
| Molecular Formula | C20H28O6P2 |
| Molecular Weight | 426.38000 |
| Flash Point | 285.3ºC |
| Exact Mass | 426.13600 |
| PSA | 90.68000 |
| LogP | 4.91000 |
| Index of Refraction | 1.523 |
| InChIKey | LCHIXNCQYDQKTP-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCCCCOP(=O)(OCC)c1ccccc1)c1ccccc1 |
|
~%
Phosphonic acid... CAS#:4151-23-9 |
| Literature: Struck Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 231 - 234 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |