1-(butyl-(4-dibutylphosphoryloxybutoxy)phosphoryl)butane structure
|
Common Name | 1-(butyl-(4-dibutylphosphoryloxybutoxy)phosphoryl)butane | ||
|---|---|---|---|---|
| CAS Number | 4151-24-0 | Molecular Weight | 410.50800 | |
| Density | 0.978g/cm3 | Boiling Point | 486.5ºC at 760 mmHg | |
| Molecular Formula | C20H44O4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.2ºC | |
| Name | 1,4-bis(dibutylphosphoryloxy)butane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978g/cm3 |
|---|---|
| Boiling Point | 486.5ºC at 760 mmHg |
| Molecular Formula | C20H44O4P2 |
| Molecular Weight | 410.50800 |
| Flash Point | 261.2ºC |
| Exact Mass | 410.27100 |
| PSA | 72.22000 |
| LogP | 7.55640 |
| Index of Refraction | 1.446 |
| InChIKey | TWWFLTQOKGFFPJ-UHFFFAOYSA-N |
| SMILES | CCCCP(=O)(CCCC)OCCCCOP(=O)(CCCC)CCCC |
| HS Code | 2931900090 |
|---|
|
~%
1-(butyl-(4-dib... CAS#:4151-24-0 |
| Literature: Struck Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 231 - 234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| butane-1,4-diyl bis[dibutyl(phosphinate)] |