Phosphinic acid,diphenyl-, 1,4-butanediyl ester (9CI) structure
|
Common Name | Phosphinic acid,diphenyl-, 1,4-butanediyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 4151-25-1 | Molecular Weight | 490.46700 | |
| Density | 1.23g/cm3 | Boiling Point | 619.8ºC at 760mmHg | |
| Molecular Formula | C28H28O4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.3ºC | |
| Name | [4-diphenylphosphoryloxybutoxy(phenyl)phosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 619.8ºC at 760mmHg |
| Molecular Formula | C28H28O4P2 |
| Molecular Weight | 490.46700 |
| Flash Point | 341.3ºC |
| Exact Mass | 490.14600 |
| PSA | 72.22000 |
| LogP | 5.65800 |
| Index of Refraction | 1.602 |
| InChIKey | DHCGGQVDXDHYFI-UHFFFAOYSA-N |
| SMILES | O=P(OCCCCOP(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
Phosphinic acid... CAS#:4151-25-1 |
| Literature: Struck Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 231 - 234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Phosphinic acid,diphenyl-,tetramethylene ester |
| diphenyl-phosphinic acid,1,4-butanediyl ester |
| butane-1,4-diyl bis[diphenyl(phosphinate)] |