2-hydroxyethyl prop-2-enoate,methyl 2-methylprop-2-enoate,styrene structure
|
Common Name | 2-hydroxyethyl prop-2-enoate,methyl 2-methylprop-2-enoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 41529-32-2 | Molecular Weight | 320.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxyethyl prop-2-enoate,methyl 2-methylprop-2-enoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H24O5 |
|---|---|
| Molecular Weight | 320.38000 |
| Exact Mass | 320.16200 |
| PSA | 72.83000 |
| LogP | 2.77300 |
| InChIKey | CDDADWWXXJGGHS-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)OCCO.C=Cc1ccccc1 |
| 2-Hydroxyethyl acrylate,methyl methacrylate,styrene polymer |
| 2-Propenoic acid,2-methyl-,methyl ester,polymer with ethenylbenzene and 2-hydroxyethyl 2-propenoate |