[5-(2-amino-6-oxo-3H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate,azane structure
|
Common Name | [5-(2-amino-6-oxo-3H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate,azane | ||
|---|---|---|---|---|
| CAS Number | 41547-83-5 | Molecular Weight | 606.43700 | |
| Density | N/A | Boiling Point | 1060.3ºC at 760 mmHg | |
| Molecular Formula | C19H27N8O13P | Melting Point | N/A | |
| MSDS | USA | Flash Point | 595ºC | |
| Name | [5-(2-amino-6-oxo-3H-purin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate,azane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 1060.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H27N8O13P |
| Molecular Weight | 606.43700 |
| Flash Point | 595ºC |
| Exact Mass | 606.14400 |
| PSA | 312.64000 |
| InChIKey | BBBUJXLTQPKTLN-UHFFFAOYSA-N |
| SMILES | N.Nc1nc2c(ncn2C2OC(CO)C(OP(=O)(O)OCC3OC(n4ccc(=O)[nH]c4=O)C(O)C3O)C2O)c(=O)[nH]1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
|
Mycobacterial RNA polymerase forms unstable open promoter complexes that are stabilized by CarD.
Nucleic Acids Res. 43(1) , 433-45, (2015) Escherichia coli has served as the archetypal organism on which the overwhelming majority of biochemical characterizations of bacterial RNA polymerase (RNAP) have been focused; the properties of E. co... |
| GpU |
| Guanylyl(3 inverted exclamation marka inverted exclamation marku5 inverted exclamation marka)uridine ammonium salt |
| Guanylyl(3'->5')uridine ammonium salt |