5-[(4-methylphenyl)diazenyl]quinolin-6-amine
Modify Date: 2025-09-25 16:45:29
![5-[(4-methylphenyl)diazenyl]quinolin-6-amine Structure](https://image.chemsrc.com/caspic/250/41554-67-0.png)
5-[(4-methylphenyl)diazenyl]quinolin-6-amine structure
|
Common Name | 5-[(4-methylphenyl)diazenyl]quinolin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 41554-67-0 | Molecular Weight | 262.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-methylphenyl)diazenyl]quinolin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N4 |
|---|---|
| Molecular Weight | 262.30900 |
| Exact Mass | 262.12200 |
| PSA | 63.63000 |
| LogP | 5.12200 |
| InChIKey | CAZZEYJUPDZVIS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Nc2c(N)ccc3ncccc23)cc1 |
|
~%
5-[(4-methylphe... CAS#:41554-67-0 |
| Literature: Ross Journal of the Chemical Society, 1948 , p. 219,222 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:42143-23-7| 5-p-Tolylazo-[6]chinolylamin |
| 6-Quinolinamine,5-[(4-methylphenyl)azo] |
| 5-p-tolylazo-[6]quinolylamine |