1-(4-methoxy-phenyl)-3-p-tolyl-propenone
1-(4-methoxy-phenyl)-3-p-tolyl-propenone structure
|
Common Name | 1-(4-methoxy-phenyl)-3-p-tolyl-propenone | ||
|---|---|---|---|---|
| CAS Number | 41564-65-2 | Molecular Weight | 252.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methoxy-phenyl)-3-p-tolyl-propenone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O2 |
|---|---|
| Molecular Weight | 252.30800 |
| Exact Mass | 252.11500 |
| PSA | 26.30000 |
| LogP | 3.89970 |
| InChIKey | QSTYRJCRRHXXQH-KPKJPENVSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(C)cc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:106511-65-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-methoxy-4-methylchalcone |
| 1-[4-Methoxy-phenyl]-3-p-tolyl-propen-(2)-on-(1) |
| 1-(4-Methoxy-phenyl)-3-(4-methyl-phenyl)-propen-1-on |
| 1-[4-Methoxy-phenyl]-3-p-tolyl-propenon |
| p-Anisyl-β-(p-tolyl)-vinyl-keton |
| p-Methylstyryl-p-methoxyphenylketon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: SMILES notation of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is COc1ccc(C(=O)C=Cc2ccc(C)cc2)cc1. |
| Q: What is the polar surface area (PSA) of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: Polar surface area (PSA) of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is 26.30000. |
| Q: What is the LogP of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: LogP of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is 3.89970. |
| Q: What are the downstream products of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: Related downstream products(CAS) of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone: 106511-65-3. |
| Q: What English synonyms does 1-(4-methoxy-phenyl)-3-p-tolyl-propenone have? |
| A: English synonyms of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone: 4'-methoxy-4-methylchalcone, 1-[4-Methoxy-phenyl]-3-p-tolyl-propen-(2)-on-(1), 1-(4-Methoxy-phenyl)-3-(4-methyl-phenyl)-propen-1-on, 1-[4-Methoxy-phenyl]-3-p-tolyl-propenon, p-Anisyl-β-(p-tolyl)-vinyl-keton, p-Methylstyryl-p-methoxyphenylketon. |
| Q: What is the English name of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: The English name of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is 1-(4-methoxy-phenyl)-3-p-tolyl-propenone. |
| Q: What is the molecular formula of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: Molecular formula of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is C17H16O2. |
| Q: What is the InChIKey of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: InChIKey of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is QSTYRJCRRHXXQH-KPKJPENVSA-N. |
| Q: What is the CAS number of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone? |
| A: CAS number of 1-(4-methoxy-phenyl)-3-p-tolyl-propenone is 41564-65-2. |
| Q: What is the Chinese name of 41564-65-2? |
| A: Chinese name of 41564-65-2 is 41564-65-2. |