4'-Amino-[1,1'-biphenyl]-4-carboxylic acid hydrochloride structure
|
Common Name | 4'-Amino-[1,1'-biphenyl]-4-carboxylic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 41567-82-2 | Molecular Weight | 249.69300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-aminophenyl)benzoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12ClNO2 |
|---|---|
| Molecular Weight | 249.69300 |
| Exact Mass | 249.05600 |
| PSA | 63.32000 |
| LogP | 4.01720 |
| InChIKey | DAIGQGYKNCXWKG-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4'-Amino-[1,1'-biphenyl]-4-carboxylic acid hydrochloride |
| OR7320 |