4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline structure
|
Common Name | 4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 41573-36-8 | Molecular Weight | 364.91100 | |
| Density | 1.138g/cm3 | Boiling Point | 496.1ºC at 760mmHg | |
| Molecular Formula | C23H25ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.8ºC | |
| Name | 4-[(2-chlorophenyl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 496.1ºC at 760mmHg |
| Molecular Formula | C23H25ClN2 |
| Molecular Weight | 364.91100 |
| Flash Point | 253.8ºC |
| Exact Mass | 364.17100 |
| PSA | 6.48000 |
| LogP | 5.65220 |
| Index of Refraction | 1.625 |
| InChIKey | JPPVTKZGOJUZKN-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2ccccc2Cl)cc1 |
| HS Code | 2921590090 |
|---|
|
~91%
4-[(2-chlorophe... CAS#:41573-36-8 |
| Literature: Mukhopadhyay, Chhanda; Datta, Arup; Tapaswi, Pradip Kumar Synthetic Communications, 2012 , vol. 42, # 16 p. 2453 - 2463 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-chloro-phenyl)-bis-(4-dimethylamino-phenyl)-methane |
| Benzenamine,4,4'-(2-chlorobenzylidene)bis(N,N-dimethyl |
| 4,4'-(2-Chlorobenzylidene)bis(N,N-dimethyl-aniline) |
| (2-Chlor-phenyl)-bis-(4-dimethylamino-phenyl)-methan |
| 4,4'-[(2-chlorophenyl)methanediyl]bis(N,N-dimethylaniline) |
| EINECS 255-443-4 |
| 2''-Chlor-4.4'-bis-dimethylamino-triphenylmethan |
| 4',4"bis(dimethylamino)-2-chlorotriphenylmethane |
| 4,4'-((2-Chlorophenyl)methylene)bis(N,N-dimethylbenzenamine) |