(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid structure
|
Common Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid | ||
|---|---|---|---|---|
| CAS Number | 4159-20-0 | Molecular Weight | 298.41900 | |
| Density | 1.027g/cm3 | Boiling Point | 468.2ºC at 760mmHg | |
| Molecular Formula | C20H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 355.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 468.2ºC at 760mmHg |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.41900 |
| Flash Point | 355.1ºC |
| Exact Mass | 298.19300 |
| PSA | 37.30000 |
| LogP | 5.37860 |
| InChIKey | SYESMXTWOAQFET-YCNIQYBTSA-N |
| SMILES | CC(C=CC1=C(C)C=CCC1(C)C)=CC=CC(C)=CC(=O)O |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Vitamin A2 acid |
| 3-Dehydroretinoic acid (6CI,7CI) |
| 3,4-didehydroretinoic acid |
| Vitamin A2 saeure |
| all-trans-3,4-Didehydro Retinoic Acid |
| Retinoic acid,3,4-didehydro |
| all-trans-Vitamin A2 Acid |
| 3-Dehydroretinoic Acid |
| 3,4-didehyroretinoic acid |
| (7E,9E,11E,13E)-9,13-dimethyl-7-(1,1,5-trimethyl-3,5-cyclohexadien-6-yl)-7,9,11,13-nonatetraen-15-oic acid |
| Ro 8-7057 |
| Vitamin A2 saeure [German] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: Related downstream products(CAS) of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid: 79-80-1;472-87-7. |
| Q: What is the boiling point of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: Boiling point of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is 468.2ºC at 760mmHg. |
| Q: What is the molecular formula of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: Molecular formula of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is C20H26O2. |
| Q: What is the English name of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: The English name of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid. |
| Q: What is the LogP of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: LogP of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is 5.37860. |
| Q: What is the SMILES notation of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: SMILES notation of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is CC(C=CC1=C(C)C=CCC1(C)C)=CC=CC(C)=CC(=O)O. |
| Q: What is the polar surface area (PSA) of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: Polar surface area (PSA) of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is 37.30000. |
| Q: What is the InChIKey of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: InChIKey of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is SYESMXTWOAQFET-YCNIQYBTSA-N. |
| Q: What is the molecular weight of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: Molecular weight of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is 298.41900. |
| Q: What is the CAS number of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid? |
| A: CAS number of (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)nona-2,4,6,8-tetraenoic acid is 4159-20-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |