[2-(N,N-Dimethylamino)phenyl]di-t-butylphosphine structure
|
Common Name | [2-(N,N-Dimethylamino)phenyl]di-t-butylphosphine | ||
|---|---|---|---|---|
| CAS Number | 415941-58-1 | Molecular Weight | 265.373981 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H28NP | Melting Point | 50-53°C | |
| MSDS | USA | Flash Point | N/A | |
| Name | Di-tert-butyl(2-dimethylaminophenyl)phosphine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 50-53°C |
|---|---|
| Molecular Formula | C16H28NP |
| Molecular Weight | 265.373981 |
| Appearance of Characters | crystal |
| InChIKey | NTJPAGHACOIILD-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccccc1P(C(C)(C)C)C(C)(C)C |
| RIDADR | NONH for all modes of transport |
|---|
| [2-(N,N-DIMETHYLAMINO)PHENYL]DI-T-BUTYLPHOSPHINE,MIN.95% |