1,4-bis[(2-ethyl-6-methylphenyl)amino]anthraquinone structure
|
Common Name | 1,4-bis[(2-ethyl-6-methylphenyl)amino]anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 41611-76-1 | Molecular Weight | 474.59300 | |
| Density | 1.218g/cm3 | Boiling Point | 616.2ºC at 760mmHg | |
| Molecular Formula | C32H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | 1,4-bis(2-ethyl-6-methylanilino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 616.2ºC at 760mmHg |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.59300 |
| Flash Point | 158.3ºC |
| Exact Mass | 474.23100 |
| PSA | 58.20000 |
| LogP | 7.83680 |
| Index of Refraction | 1.674 |
| InChIKey | NPJJGMRERPXCSE-UHFFFAOYSA-N |
| SMILES | CCc1cccc(C)c1Nc1ccc(Nc2c(C)cccc2CC)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~77%
1,4-bis[(2-ethy... CAS#:41611-76-1 |
| Literature: LANXESS Deutschland GmbH Patent: US2008/139830 A1, 2008 ; Location in patent: Page/Page column 6 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,4-bis-(2-ethyl-6-methylanilino)-anthraquinone |
| Benzene,1,4-bis[2-(2-chlorophenyl)ethenyl] |
| 1,4-bis(2-chlorostyryl)benzene |