6,7-dimethoxy-2,3-dimethyl-quinazolin-4-one structure
|
Common Name | 6,7-dimethoxy-2,3-dimethyl-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 41632-01-3 | Molecular Weight | 234.25100 | |
| Density | 1.22g/cm3 | Boiling Point | 393.5ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | 6,7-dimethoxy-2,3-dimethylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 393.5ºC at 760 mmHg |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25100 |
| Flash Point | 191.8ºC |
| Exact Mass | 234.10000 |
| PSA | 53.35000 |
| LogP | 1.25910 |
| Index of Refraction | 1.569 |
| InChIKey | GKJZZPGNBQWSAV-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(C)n(C)c(=O)c2cc1OC |
| HS Code | 2933990090 |
|---|
|
~91%
6,7-dimethoxy-2... CAS#:41632-01-3 |
| Literature: Lempert-Sreter, Magda; Lempert, Karoly; Moeller, Joergen Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 6 p. 1143 - 1152 |
|
~24%
6,7-dimethoxy-2... CAS#:41632-01-3 |
| Literature: Lempert-Sreter, Magda; Lempert, Karoly; Moeller, Joergen Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 6 p. 1143 - 1152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-dimethoxy-2,3-dimethylquinazoline-4(3H)-one |
| 6,7-dimethoxy-2,3-dimethyl-3H-quinazolin-4-one |
| 6,7-Dimethoxy-2,3-dimethyl-4-oxo-3,4-dihydrochinazolin |