(+)-(3Ar,4R,5R,6as)-hexahydro-5-hydroxy-4-[(1E,3R)-3-hydroxy-5-phenyl-1-pentenyl]-2H-cyclopenta[b]furan-2-one structure
|
Common Name | (+)-(3Ar,4R,5R,6as)-hexahydro-5-hydroxy-4-[(1E,3R)-3-hydroxy-5-phenyl-1-pentenyl]-2H-cyclopenta[b]furan-2-one | ||
|---|---|---|---|---|
| CAS Number | 41639-74-1 | Molecular Weight | 302.365 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 509.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.6±23.6 °C | |
| Name | (3aR,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 509.2±50.0 °C at 760 mmHg |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.365 |
| Flash Point | 185.6±23.6 °C |
| Exact Mass | 302.151794 |
| PSA | 66.76000 |
| LogP | 0.62 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | PFIFPUGALHSEKD-RKCGEVCRSA-N |
| SMILES | O=C1CC2C(CC(O)C2C=CC(O)CCc2ccccc2)O1 |
| HS Code | 2918199090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (3aR,4R,5R,6aS)-5-Hydroxy-4-((S,E)-3-hydroxy-5-phenylpent-1-en-1-yl)hexahydro-2H-cyclopenta[b]furan-2-one |
| (3aR,4R,5R,6aS)-5-Hydroxy-4-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one |
| 1(S)-2oxa-3-oxo-6R-(3S-hydroxy-5-phenyl-1-trans-pentenyl)-(7R)-hydroxy-cis-bicyclo[3.3.0]octane |
| 2H-Cyclopenta[b]furan-2-one, hexahydro-5-hydroxy-4-[(1E,3S)-3-hydroxy-5-phenyl-1-penten-1-yl]-, (3aR,4R,5R,6aS)- |
| (3aR,4R,5R,6aS)-5-Hydroxy-4-[(1E,3S)-3-hydroxy-5-phenylpent-1-en-1-yl]hexahydro-2H-cyclopenta[b]furan-2-one |
| (1S,5R,6R,7R)-6-[(3S)-3-hydroxy-5-phenyl-1-E-pentenyl]-7-hydroxy-2-oxabicyclo[3.3.0]octan-3-one |