4-arsoroso-N,N-bis(2-chloroethyl)aniline
4-arsoroso-N,N-bis(2-chloroethyl)aniline structure
|
Common Name | 4-arsoroso-N,N-bis(2-chloroethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 4164-07-2 | Molecular Weight | 308.03600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12AsCl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-arsoroso-N,N-bis(2-chloroethyl)aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12AsCl2NO |
|---|---|
| Molecular Weight | 308.03600 |
| Exact Mass | 306.95100 |
| PSA | 20.31000 |
| LogP | 1.64560 |
| InChIKey | RVHXTBHJZUZADA-UHFFFAOYSA-N |
| SMILES | O=[As]c1ccc(N(CCCl)CCCl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-arsoroso-N,N-... CAS#:4164-07-2 |
| Literature: Bardos; Datta-Gupta; Hebborn Journal of medicinal chemistry, 1966 , vol. 9, # 2 p. 221 - 227 |
![4-[N,N-Bis(2-chloroethyl)amino]phenylarsonic acid structure](https://image.chemsrc.com/caspic/044/5185-71-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:5185-77-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-arsenoso-N,N-bis-(2-chloro-ethyl)-aniline cyclooligomers |
| p-Arsenoso-N,N-bis(2-chloroethyl)aniline |
| N,N-bis(2-chloroethyl)-4-(oxoarsanyl)aniline |
| ANILINE,p-ARSENOSO-N,N-BIS(2-CHLOROETHYL) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: LogP of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is 1.64560. |
| Q: What is the molecular weight of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: Molecular weight of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is 308.03600. |
| Q: What is the CAS number of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: CAS number of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is 4164-07-2. |
| Q: What English synonyms does 4-arsoroso-N,N-bis(2-chloroethyl)aniline have? |
| A: English synonyms of 4-arsoroso-N,N-bis(2-chloroethyl)aniline: 4-arsenoso-N,N-bis-(2-chloro-ethyl)-aniline cyclooligomers, p-Arsenoso-N,N-bis(2-chloroethyl)aniline, N,N-bis(2-chloroethyl)-4-(oxoarsanyl)aniline, ANILINE,p-ARSENOSO-N,N-BIS(2-CHLOROETHYL). |
| Q: What is the Chinese name of 4164-07-2? |
| A: Chinese name of 4164-07-2 is 4164-07-2. |
| Q: What is the English name of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: The English name of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is 4-arsoroso-N,N-bis(2-chloroethyl)aniline. |
| Q: What is the polar surface area (PSA) of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: Polar surface area (PSA) of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is 20.31000. |
| Q: What is the molecular formula of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: Molecular formula of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is C10H12AsCl2NO. |
| Q: What is the SMILES notation of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: SMILES notation of 4-arsoroso-N,N-bis(2-chloroethyl)aniline is O=[As]c1ccc(N(CCCl)CCCl)cc1. |
| Q: What are the downstream products of 4-arsoroso-N,N-bis(2-chloroethyl)aniline? |
| A: Related downstream products(CAS) of 4-arsoroso-N,N-bis(2-chloroethyl)aniline: 5185-71-7;5185-77-3. |