4-[3-(4-chlorobenzoyl)-2-methylphenyl]butanoic acid
Modify Date: 2025-08-26 11:33:11
![4-[3-(4-chlorobenzoyl)-2-methylphenyl]butanoic acid Structure](https://image.chemsrc.com/caspic/431/41651-99-4.png)
4-[3-(4-chlorobenzoyl)-2-methylphenyl]butanoic acid structure
|
Common Name | 4-[3-(4-chlorobenzoyl)-2-methylphenyl]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 41651-99-4 | Molecular Weight | 316.77900 | |
| Density | 1.236g/cm3 | Boiling Point | 480.3ºC at 760 mmHg | |
| Molecular Formula | C18H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.3ºC | |
| Name | 4-[3-(4-chlorobenzoyl)-2-methylphenyl]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 480.3ºC at 760 mmHg |
| Molecular Formula | C18H17ClO3 |
| Molecular Weight | 316.77900 |
| Flash Point | 244.3ºC |
| Exact Mass | 316.08700 |
| PSA | 54.37000 |
| LogP | 4.28670 |
| Index of Refraction | 1.587 |
| InChIKey | IFJDHARPMATWIG-UHFFFAOYSA-N |
| SMILES | Cc1c(CCCC(=O)O)cccc1C(=O)c1ccc(Cl)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
4-[3-(4-chlorob... CAS#:41651-99-4 |
| Literature: Roussel-UCLAF Patent: US3931302 A1, 1976 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-[2-Methyl-3-(4-chlorobenzoyl)phenyl]butanoic acid |
| 4-(3'-p-chlorobenzoyl-2'-methyl-phenyl)-butyric acid |