methyl 3-[(2-chloroacetyl)amino]benzoate structure
|
Common Name | methyl 3-[(2-chloroacetyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 41653-05-8 | Molecular Weight | 227.64400 | |
| Density | 1.325g/cm3 | Boiling Point | 409.6ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5ºC | |
| Name | methyl 3-[(2-chloroacetyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 409.6ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64400 |
| Flash Point | 201.5ºC |
| Exact Mass | 227.03500 |
| PSA | 55.40000 |
| LogP | 1.72350 |
| Index of Refraction | 1.579 |
| InChIKey | FRBYDITWHMOOIR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(NC(=O)CCl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 3-(2-chloroacetamido)benzoate |
| methyl 3-[(chloroacetyl)amino]benzoate |