2,4-di-tert-butyl-6-chlorophenol structure
|
Common Name | 2,4-di-tert-butyl-6-chlorophenol | ||
|---|---|---|---|---|
| CAS Number | 4166-86-3 | Molecular Weight | 240.76900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-di-tert-butyl-6-chlorophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21ClO |
|---|---|
| Molecular Weight | 240.76900 |
| Exact Mass | 240.12800 |
| PSA | 20.23000 |
| LogP | 4.64060 |
| InChIKey | CWSNVVXDGQVVDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cl)c(O)c(C(C)(C)C)c1 |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,4-di-tert-butyl-6-chloro-phenol |
| 4,6-di-tert-butyl-2-chlorophenol |
| 2-chloro-4,6-di-tert-butylphenol |
| 2,4-di-t-butyl-6-chlorophenol |
| 5-Chlor-4-hydroxy-1.3-di-tert.-butyl-benzol |