2,6-ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione
![2,6-ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione Structure](https://image.chemsrc.com/caspic/270/41675-68-7.png)
2,6-ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione structure
|
Common Name | 2,6-ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione | ||
|---|---|---|---|---|
| CAS Number | 41675-68-7 | Molecular Weight | 249.30600 | |
| Density | 1.14g/cm3 | Boiling Point | 402.8ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
Summary: 2,6-Ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione (CAS number: 41675-68-7) is a chemical with molecular formula C14H19NO3 and molecular weight 249.30600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 197.4ºC |
| Exact Mass | 249.13600 |
| PSA | 55.40000 |
| LogP | 2.60220 |
| Index of Refraction | 1.532 |
| InChIKey | GFWDVSZNVQRSSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=c2oc(O)c(C(C)(C)C)c2=NC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,6-ditert-buty... CAS#:41675-68-7 |
| Literature: Weyler,W. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 3865 - 3868 |
![5,8-ditert-butylfuro[1,2]pyrrolo[2,5-c]tetrazol-6-one structure](https://image.chemsrc.com/caspic/384/41675-65-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,6-di-tert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: The English name of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione. |
| Q: What is the molecular formula of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: Molecular formula of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is C14H19NO3. |
| Q: What are the upstream materials of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: Related upstream materials(CAS) of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione: 41675-65-4. |
| Q: What is the LogP of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: LogP of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is 2.60220. |
| Q: What is the polar surface area (PSA) of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: Polar surface area (PSA) of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is 55.40000. |
| Q: What is the molecular weight of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: Molecular weight of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is 249.30600. |
| Q: What is the InChIKey of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: InChIKey of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is GFWDVSZNVQRSSU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 41675-68-7? |
| A: Chinese name of 41675-68-7 is 41675-68-7. |
| Q: What is the CAS number of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione? |
| A: CAS number of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione is 41675-68-7. |
| Q: What English synonyms does 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione have? |
| A: English synonyms of 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione: 3,6-di-tert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |