2,6-ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione structure
|
Common Name | 2,6-ditert-butyl-8-oxa-4-azabicyclo[3.3.0]octa-1,5-diene-3,7-dione | ||
|---|---|---|---|---|
| CAS Number | 41675-68-7 | Molecular Weight | 249.30600 | |
| Density | 1.14g/cm3 | Boiling Point | 402.8ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 3,6-ditert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 197.4ºC |
| Exact Mass | 249.13600 |
| PSA | 55.40000 |
| LogP | 2.60220 |
| Index of Refraction | 1.532 |
| InChIKey | GFWDVSZNVQRSSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=c2oc(O)c(C(C)(C)C)c2=NC1=O |
|
~%
2,6-ditert-buty... CAS#:41675-68-7 |
| Literature: Weyler,W. et al. Journal of Organic Chemistry, 1973 , vol. 38, p. 3865 - 3868 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,6-di-tert-butyl-4H-furo[3,2-b]pyrrole-2,5-dione |