2,5-bis(4-methoxyanilino)terephthalic acid structure
|
Common Name | 2,5-bis(4-methoxyanilino)terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 41680-75-5 | Molecular Weight | 408.40400 | |
| Density | 1.386g/cm3 | Boiling Point | 609.1ºC at 760 mmHg | |
| Molecular Formula | C22H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.2ºC | |
| Name | 2,5-bis(4-methoxyanilino)terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 609.1ºC at 760 mmHg |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.40400 |
| Flash Point | 322.2ºC |
| Exact Mass | 408.13200 |
| PSA | 117.12000 |
| LogP | 4.73340 |
| Index of Refraction | 1.687 |
| InChIKey | UHNQJYAKDVEVGU-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2cc(C(=O)O)c(Nc3ccc(OC)cc3)cc2C(=O)O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-di(p-methoxyanilino)terephthalic acid |
| 2,5-dianisidino-terephthalic acid |
| 2,5-Bis{(4-methoxyphenyl)amino}terephthalic acid |
| 2,5-di(4-methoxy-anilino)terephthalic acid |
| 2,5-di-p-anisidino-terephthalic acid |
| 1,4-Benzenedicarboxylic acid,2,5-bis((4-methoxyphenyl)amino) |
| 2,5-Di-p-anisidino-terephthalsaeure |