4-chloro-N-(3-hydroxyphenyl)-3-nitrobenzamide structure
|
Common Name | 4-chloro-N-(3-hydroxyphenyl)-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 416887-71-3 | Molecular Weight | 292.67500 | |
| Density | 1.536g/cm3 | Boiling Point | 415.8ºC at 760 mmHg | |
| Molecular Formula | C13H9ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | 4-chloro-N-(3-hydroxyphenyl)-3-nitrobenzamide |
|---|
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 415.8ºC at 760 mmHg |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.67500 |
| Flash Point | 205.3ºC |
| Exact Mass | 292.02500 |
| PSA | 95.15000 |
| LogP | 3.80230 |
| Index of Refraction | 1.706 |
| InChIKey | VPAQNRRSTOJURQ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |