tert-butylsulfonylbenzene structure
|
Common Name | tert-butylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 4170-72-3 | Molecular Weight | 198.28200 | |
| Density | 1.096g/cm3 | Boiling Point | 323.4ºC at 760 mmHg | |
| Molecular Formula | C10H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.6ºC | |
| Name | tert-butylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 323.4ºC at 760 mmHg |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.28200 |
| Flash Point | 171.6ºC |
| Exact Mass | 198.07100 |
| PSA | 42.52000 |
| LogP | 3.33960 |
| Index of Refraction | 1.51 |
| InChIKey | LGMGPNAOZRUYCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)S(=O)(=O)c1ccccc1 |
| HS Code | 2904100000 |
|---|
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| tert.-Butylsulfon-benzol |
| tert-butyl-phenyl sulfone |
| Phenyl tert-butylsulfone |
| Phenyl t-butyl sulfone |
| t-butyl phenyl sulfone |