2-Cyclopentyl-1-(4-methoxy-2,3-dimethylphenyl)ethanone structure
|
Common Name | 2-Cyclopentyl-1-(4-methoxy-2,3-dimethylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 41715-81-5 | Molecular Weight | 246.34500 | |
| Density | 1.016 | Boiling Point | 387.574ºC at 760 mmHg | |
| Molecular Formula | C16H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.635ºC | |
| Name | 2-Cyclopentyl-1-(4-methoxy-2,3-dimethylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.016 |
|---|---|
| Boiling Point | 387.574ºC at 760 mmHg |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.34500 |
| Flash Point | 166.635ºC |
| Exact Mass | 246.16200 |
| PSA | 26.30000 |
| LogP | 4.07500 |
| Index of Refraction | 1.52 |
| InChIKey | MZZHYECANRLDFJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CC2CCCC2)c(C)c1C |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2'-cyclopentyl-2,3-dimethyl-4-methoxyacetophenone |
| 2',3'-Dimethyl-4'-methoxycyclopentylacetophenon |