3-Methoxy-9-(2-pyrrolidin-1-yl-ethyl)-9H-carbazole; compound with oxalic acid structure
|
Common Name | 3-Methoxy-9-(2-pyrrolidin-1-yl-ethyl)-9H-carbazole; compound with oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 41734-83-2 | Molecular Weight | 384.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Methoxy-9-(2-pyrrolidin-1-yl-ethyl)-9H-carbazole; compound with oxalic acid |
|---|
| Molecular Formula | C21H24N2O5 |
|---|---|
| Molecular Weight | 384.42600 |
| Exact Mass | 384.16900 |
| PSA | 92.00000 |
| LogP | 2.99240 |
| InChIKey | USIOTPACRUDXFZ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c1ccccc1n2CCN1CCCC1.O=C(O)C(=O)O |