1-(2,2,4,6-tetramethylpiperazin-1-yl)propan-1-one structure
|
Common Name | 1-(2,2,4,6-tetramethylpiperazin-1-yl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 4177-42-8 | Molecular Weight | 198.30500 | |
| Density | 0.923g/cm3 | Boiling Point | 282.1ºC at 760 mmHg | |
| Molecular Formula | C11H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.5ºC | |
| Name | 1-(2,2,4,6-tetramethylpiperazin-1-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.923g/cm3 |
|---|---|
| Boiling Point | 282.1ºC at 760 mmHg |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.30500 |
| Flash Point | 104.5ºC |
| Exact Mass | 198.17300 |
| PSA | 23.55000 |
| LogP | 1.21330 |
| Index of Refraction | 1.454 |
| InChIKey | UBGGREWUFINDKK-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1C(C)CN(C)CC1(C)C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Propionyl-2,2,4,6-tetramethyl piperazine |
| 2,2,4,6-tetramethyl-1-propionyl-piperazine |
| 1-Propionyl-2,2,4,6-tetramethyl-piperazin |
| Piperazine,1-propionyl-2,2,4,6-tetramethyl |