1-methyl-4-(1-nitrocyclohexyl)sulfonylbenzene structure
|
Common Name | 1-methyl-4-(1-nitrocyclohexyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 41774-12-3 | Molecular Weight | 283.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-(1-nitrocyclohexyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H17NO4S |
|---|---|
| Molecular Weight | 283.34300 |
| Exact Mass | 283.08800 |
| PSA | 88.34000 |
| LogP | 4.30980 |
| InChIKey | LQWHWFTZSFBTCN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C2([N+](=O)[O-])CCCCC2)cc1 |
|
~%
1-methyl-4-(1-n... CAS#:41774-12-3 |
| Literature: Kornblum,N. et al. Journal of the American Chemical Society, 1973 , vol. 95, p. 3356 - 3361 |
|
~%
1-methyl-4-(1-n... CAS#:41774-12-3 |
| Literature: Zeilstra,J.J.; Engberts,J.B.F.N. Recueil des Travaux Chimiques des Pays-Bas, 1974 , vol. 93, p. 11 - 14 |
| 1-nitro-1-(p-tolylsulfonyl)cyclohexane |
| Benzene,1-methyl-4-[(1-nitrocyclohexyl)sulfonyl] |
| 1-(p-tolylsulfonyl)-1-nitrocyclohexane |
| 1-methyl-4-[(1-nitrocyclohexane)sulfonyl]benzene |
| 1-nitro-1-(p-toluenesulfonyl)cyclohexane |
| 1-<(p-methylphenyl)sulfonyl>-1-nitrocyclohexane |