3-[(1-propyl-pentyloxyimino)-methyl]-rifamycin structure
|
Common Name | 3-[(1-propyl-pentyloxyimino)-methyl]-rifamycin | ||
|---|---|---|---|---|
| CAS Number | 41776-72-1 | Molecular Weight | 853.00600 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C46H64N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(1-propyl-pentyloxyimino)-methyl]-rifamycin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Molecular Formula | C46H64N2O13 |
| Molecular Weight | 853.00600 |
| Exact Mass | 852.44100 |
| PSA | 222.90000 |
| LogP | 7.22110 |
| Index of Refraction | 1.591 |
| InChIKey | AWYBPYFQAUNGQR-YMLYEDPPSA-N |
| SMILES | CCCCC(CCC)ON=Cc1c2c(O)c3c(O)c(C)c4c(c3c1O)C(=O)C(C)(OC=CC(OC)C(C)C(OC(C)=O)C(C)C(O)C(C)C(O)C(C)C=CC=C(C)C(=O)N2)O4 |
|
~%
3-[(1-propyl-pe... CAS#:41776-72-1 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
|
~%
3-[(1-propyl-pe... CAS#:41776-72-1 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,7-(Epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-1,11(2H)-dione,3-formyl-5,6,9,17,19,21-hexahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-,21-acetate,O-(oct-4-yl)oxime |
| 3-Formylrifamycin SV O-(oct-4-yl)oxime |
| 3-Formylrifamycin SV O-n-Oct-4-yloxim |
| rifaldehyde O-(1-propyl-pentyl)-oxime |