Octadecanoic acid, 9,12-dioxo- structure
|
Common Name | Octadecanoic acid, 9,12-dioxo- | ||
|---|---|---|---|---|
| CAS Number | 4179-48-0 | Molecular Weight | 312.44400 | |
| Density | 0.993g/cm3 | Boiling Point | 481.9ºC at 760 mmHg | |
| Molecular Formula | C18H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.4ºC | |
| Name | 9,12-dioxooctadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.993g/cm3 |
|---|---|
| Boiling Point | 481.9ºC at 760 mmHg |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.44400 |
| Flash Point | 259.4ºC |
| Exact Mass | 312.23000 |
| PSA | 71.44000 |
| LogP | 4.69050 |
| Index of Refraction | 1.465 |
| InChIKey | XZWUJWRGRUQXOC-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)CCC(=O)CCCCCCCC(=O)O |
| HS Code | 2918300090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9,12-Dioxo-octadecanoic acid |
| Octadecanoic acid,12-dioxo |
| 9,12-Dioxo-octadecansaeure |
| 9,12-diketo-octadecanoic acid |
| 9.12-Diketooctadecansaeure |
| Octadecanoic acid,9,12-dioxo |