2,4-dinitro-6-pentylphenol
2,4-dinitro-6-pentylphenol structure
|
Common Name | 2,4-dinitro-6-pentylphenol | ||
|---|---|---|---|---|
| CAS Number | 4182-71-2 | Molecular Weight | 254.23900 | |
| Density | 1.311g/cm3 | Boiling Point | 381.7ºC at 760mmHg | |
| Molecular Formula | C11H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dinitro-6-pentylphenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 381.7ºC at 760mmHg |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.23900 |
| Flash Point | 160ºC |
| Exact Mass | 254.09000 |
| PSA | 111.87000 |
| LogP | 3.98770 |
| InChIKey | FCPJYWJEVFRRKH-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2908999090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dinitro-6-p... CAS#:4182-71-2 |
| Literature: Dutton et al. Canadian Journal of Chemistry, 1953 , vol. 31, p. 837,839 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3.5-Dinitro-2-hydroxy-1-pentyl-benzol |
| Phenol,2,4-dinitro-6-pentyl |
| 3.5-dinitro-2-hydroxy-1-pentyl-benzene |
| 2-Pentyl-4,6-dinitrophenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2,4-dinitro-6-pentylphenol? |
| A: Related upstream materials(CAS) of 2,4-dinitro-6-pentylphenol: 136-81-2. |
| Q: What is the English name of 2,4-dinitro-6-pentylphenol? |
| A: The English name of 2,4-dinitro-6-pentylphenol is 2,4-dinitro-6-pentylphenol. |
| Q: What is the boiling point of 2,4-dinitro-6-pentylphenol? |
| A: Boiling point of 2,4-dinitro-6-pentylphenol is 381.7ºC at 760mmHg. |
| Q: What is the molecular formula of 2,4-dinitro-6-pentylphenol? |
| A: Molecular formula of 2,4-dinitro-6-pentylphenol is C11H14N2O5. |
| Q: What is the Chinese name of 4182-71-2? |
| A: Chinese name of 4182-71-2 is 4182-71-2. |
| Q: What is the polar surface area (PSA) of 2,4-dinitro-6-pentylphenol? |
| A: Polar surface area (PSA) of 2,4-dinitro-6-pentylphenol is 111.87000. |
| Q: What is the LogP of 2,4-dinitro-6-pentylphenol? |
| A: LogP of 2,4-dinitro-6-pentylphenol is 3.98770. |
| Q: What is the CAS number of 2,4-dinitro-6-pentylphenol? |
| A: CAS number of 2,4-dinitro-6-pentylphenol is 4182-71-2. |
| Q: What is the SMILES notation of 2,4-dinitro-6-pentylphenol? |
| A: SMILES notation of 2,4-dinitro-6-pentylphenol is CCCCCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O. |
| Q: What is the molecular weight of 2,4-dinitro-6-pentylphenol? |
| A: Molecular weight of 2,4-dinitro-6-pentylphenol is 254.23900. |