2,4-dinitro-6-pentylphenol structure
|
Common Name | 2,4-dinitro-6-pentylphenol | ||
|---|---|---|---|---|
| CAS Number | 4182-71-2 | Molecular Weight | 254.23900 | |
| Density | 1.311g/cm3 | Boiling Point | 381.7ºC at 760mmHg | |
| Molecular Formula | C11H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | 2,4-dinitro-6-pentylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 381.7ºC at 760mmHg |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.23900 |
| Flash Point | 160ºC |
| Exact Mass | 254.09000 |
| PSA | 111.87000 |
| LogP | 3.98770 |
| InChIKey | FCPJYWJEVFRRKH-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| HS Code | 2908999090 |
|---|
|
~%
2,4-dinitro-6-p... CAS#:4182-71-2 |
| Literature: Dutton et al. Canadian Journal of Chemistry, 1953 , vol. 31, p. 837,839 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3.5-Dinitro-2-hydroxy-1-pentyl-benzol |
| Phenol,2,4-dinitro-6-pentyl |
| 3.5-dinitro-2-hydroxy-1-pentyl-benzene |
| 2-Pentyl-4,6-dinitrophenol |