1-(2-chlorophenyl)-2-(4-methoxyphenyl)ethane-1,2-dione structure
|
Common Name | 1-(2-chlorophenyl)-2-(4-methoxyphenyl)ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 41841-01-4 | Molecular Weight | 274.69900 | |
| Density | 1.269g/cm3 | Boiling Point | 436.8ºC at 760 mmHg | |
| Molecular Formula | C15H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 1-(2-chlorophenyl)-2-(4-methoxyphenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 436.8ºC at 760 mmHg |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.69900 |
| Flash Point | 180.6ºC |
| Exact Mass | 274.04000 |
| PSA | 43.37000 |
| LogP | 3.41420 |
| Index of Refraction | 1.588 |
| InChIKey | XQQVCLAFSXCQJR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(=O)c2ccccc2Cl)cc1 |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-CHLORO-4'-METHOXYBENZIL |
| 2-Chlor-4'-methoxy-benzil |