Acetamidine,2,2-diphenyl-N'-p-tolyl- (7CI,8CI)
Acetamidine,2,2-diphenyl-N'-p-tolyl- (7CI,8CI) structure
|
Common Name | Acetamidine,2,2-diphenyl-N'-p-tolyl- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 4185-22-2 | Molecular Weight | 300.39700 | |
| Density | 1.05g/cm3 | Boiling Point | 483.2ºC at 760 mmHg | |
| Molecular Formula | C21H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N'-(4-methylphenyl)-2,2-diphenylethanimidamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 483.2ºC at 760 mmHg |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.39700 |
| Flash Point | 246ºC |
| Exact Mass | 300.16300 |
| PSA | 38.38000 |
| LogP | 5.51610 |
| Index of Refraction | 1.59 |
| InChIKey | YGINBZOVBWUPNW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C(N)C(c2ccccc2)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Acetamidine,2,2... CAS#:4185-22-2 |
| Literature: Stevens,C.L. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3718 - 3720 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: InChIKey of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is YGINBZOVBWUPNW-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: Polar surface area (PSA) of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is 38.38000. |
| Q: What is the molecular weight of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: Molecular weight of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is 300.39700. |
| Q: What is the molecular formula of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: Molecular formula of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is C21H20N2. |
| Q: What is the Chinese name of 4185-22-2? |
| A: Chinese name of 4185-22-2 is 4185-22-2. |
| Q: What is the English name of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: The English name of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is N'-(4-methylphenyl)-2,2-diphenylethanimidamide. |
| Q: What is the SMILES notation of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: SMILES notation of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is Cc1ccc(N=C(N)C(c2ccccc2)c2ccccc2)cc1. |
| Q: What is the LogP of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: LogP of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is 5.51610. |
| Q: What are the upstream materials of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: Related upstream materials(CAS) of N'-(4-methylphenyl)-2,2-diphenylethanimidamide: 5110-45-2. |
| Q: What is the CAS number of N'-(4-methylphenyl)-2,2-diphenylethanimidamide? |
| A: CAS number of N'-(4-methylphenyl)-2,2-diphenylethanimidamide is 4185-22-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |