Acetamidine,2,2-diphenyl-N'-p-tolyl- (7CI,8CI) structure
|
Common Name | Acetamidine,2,2-diphenyl-N'-p-tolyl- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 4185-22-2 | Molecular Weight | 300.39700 | |
| Density | 1.05g/cm3 | Boiling Point | 483.2ºC at 760 mmHg | |
| Molecular Formula | C21H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246ºC | |
| Name | N'-(4-methylphenyl)-2,2-diphenylethanimidamide |
|---|
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 483.2ºC at 760 mmHg |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.39700 |
| Flash Point | 246ºC |
| Exact Mass | 300.16300 |
| PSA | 38.38000 |
| LogP | 5.51610 |
| Index of Refraction | 1.59 |
| InChIKey | YGINBZOVBWUPNW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C(N)C(c2ccccc2)c2ccccc2)cc1 |
|
~%
Acetamidine,2,2... CAS#:4185-22-2 |
| Literature: Stevens,C.L. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 3718 - 3720 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |