N-Nitroso-N-methyl-DL-phenylalanine structure
|
Common Name | N-Nitroso-N-methyl-DL-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 41867-08-7 | Molecular Weight | 208.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Nitroso-N-methyl-DL-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12N2O3 |
|---|---|
| Molecular Weight | 208.21400 |
| Exact Mass | 208.08500 |
| PSA | 69.97000 |
| LogP | 1.29550 |
| InChIKey | NXGUHURLWSHFBF-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(Cc1ccccc1)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
N-Nitroso-N-met... CAS#:41867-08-7 |
| Literature: Brookes; Walker Journal of the Chemical Society, 1957 , p. 4409,4416 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-[methyl(nitroso)amino]-3-phenylpropanoic acid |