(1S)-1-(4-Nitrophenyl)ethanamine structure
|
Common Name | (1S)-1-(4-Nitrophenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 4187-53-5 | Molecular Weight | 166.177 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 288.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.4±22.6 °C | |
| Name | (1S)-1-(4-nitrophenyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.8±23.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.177 |
| Flash Point | 128.4±22.6 °C |
| Exact Mass | 166.074234 |
| PSA | 71.84000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | RAEVOBPXEHVUFY-LURJTMIESA-N |
| SMILES | CC(N)c1ccc([N+](=O)[O-])cc1 |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
|
Name: Chan-Lam from Article : "Open science discovery of potent noncovalent SARS-CoV-2 main...
Source: BindingDB
Target: N/A
External Id: BindingDB_11549_1
|
| (S)-4-Nitro-alpha-methylbenzylamine |
| (1S)-1-(4-Nitrophenyl)ethanamine |
| (S)-(+)-α-methyl-4-nitrobenzylamine |