5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide
5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide structure
|
Common Name | 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide | ||
|---|---|---|---|---|
| CAS Number | 41877-80-9 | Molecular Weight | 246.69200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11ClN2O |
|---|---|
| Molecular Weight | 246.69200 |
| Exact Mass | 246.05600 |
| PSA | 67.87000 |
| LogP | 3.65968 |
| InChIKey | HDPCUXRMKMKCJQ-CZIBKUHYSA-N |
| SMILES | Cc1ccc(C(Cl)=CC=C(C#N)C(N)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-chloro-2-cyan... CAS#:41877-80-9 |
| Literature: Liebscher,J.; Hartmann,H. Synthesis, 1979 , p. 241 - 264 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: Molecular weight of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is 246.69200. |
| Q: What is the English name of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: The English name of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide. |
| Q: What is the InChIKey of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: InChIKey of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is HDPCUXRMKMKCJQ-CZIBKUHYSA-N. |
| Q: What is the LogP of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: LogP of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is 3.65968. |
| Q: What is the Chinese name of 41877-80-9? |
| A: Chinese name of 41877-80-9 is 41877-80-9. |
| Q: What is the polar surface area (PSA) of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: Polar surface area (PSA) of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is 67.87000. |
| Q: What is the molecular formula of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: Molecular formula of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is C13H11ClN2O. |
| Q: What is the SMILES notation of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: SMILES notation of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is Cc1ccc(C(Cl)=CC=C(C#N)C(N)=O)cc1. |
| Q: What is the CAS number of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: CAS number of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide is 41877-80-9. |
| Q: What are the upstream materials of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide? |
| A: Related upstream materials(CAS) of 5-chloro-2-cyano-5-(4-methylphenyl)penta-2,4-dienamide: 7089-19-2;107-91-5. |