N-[(2-nitrophenyl)methyl]-2-phenylethanamine structure
|
Common Name | N-[(2-nitrophenyl)methyl]-2-phenylethanamine | ||
|---|---|---|---|---|
| CAS Number | 418774-35-3 | Molecular Weight | 256.30000 | |
| Density | 1.164g/cm3 | Boiling Point | 393.5ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | N-[(2-nitrophenyl)methyl]-2-phenylethanamine |
|---|
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 393.5ºC at 760 mmHg |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30000 |
| Flash Point | 191.8ºC |
| Exact Mass | 256.12100 |
| PSA | 57.85000 |
| LogP | 3.84120 |
| Index of Refraction | 1.597 |
| InChIKey | SOLIXLJHUXVLDH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1CNCCc1ccccc1 |
| HS Code | 2921499090 |
|---|
|
~%
N-[(2-nitrophen... CAS#:418774-35-3 |
| Literature: Kumar, R. Arun; Maheswari, C. Uma; Ghantasala, Satheesh; Jyothi; Reddy, K. Rajender Advanced Synthesis and Catalysis, 2011 , vol. 353, # 2-3 p. 401 - 410 |
|
~%
N-[(2-nitrophen... CAS#:418774-35-3 |
| Literature: Ishikawa; Watanabe; Saegusa Chemical and pharmaceutical bulletin, 1980 , vol. 28, # 5 p. 1357 - 1364 |
|
~%
N-[(2-nitrophen... CAS#:418774-35-3 |
| Literature: Ishikawa; Watanabe; Saegusa Chemical and pharmaceutical bulletin, 1980 , vol. 28, # 5 p. 1357 - 1364 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|