3-Formylrifamycin SV O-farnesyloxime structure
|
Common Name | 3-Formylrifamycin SV O-farnesyloxime | ||
|---|---|---|---|---|
| CAS Number | 41887-55-2 | Molecular Weight | 945.14400 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C53H72N2O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Formylrifamycin SV O-farnesyloxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C53H72N2O13 |
| Molecular Weight | 945.14400 |
| Exact Mass | 944.50300 |
| PSA | 222.90000 |
| LogP | 9.28140 |
| Index of Refraction | 1.593 |
| InChIKey | OJPCIWGYWKUXNM-ANJSYAIPSA-N |
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(C=NOCC=C(C)CCC=C(C)CCC=C(C)C)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C |
|
~%
3-Formylrifamyc... CAS#:41887-55-2 |
| Literature: Cricchio; Lancini; Tamborini; Sensi Journal of Medicinal Chemistry, 1974 , vol. 17, # 4 p. 396 - 403 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Formylrifamycin SV-O-Farnesyloxim |