5,6-Dimethoxy-2-methyl-1-indanone structure
|
Common Name | 5,6-Dimethoxy-2-methyl-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 4191-17-7 | Molecular Weight | 206.238 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 342.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1±14.3 °C | |
| Name | 5,6-Dimethoxy-2-methyl-2,3-dihydro-1H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.5±42.0 °C at 760 mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Flash Point | 152.1±14.3 °C |
| Exact Mass | 206.094299 |
| PSA | 35.53000 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | DRWBHZSJKUMHGN-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)C(C)C2 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Inhibition of acetylcholinesterase.
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL648290
|
|
Name: IC50 against acetylcholinesterase; value ranges from 1.3-380 nM.
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL643383
|
| 5,6-dimethoxy-2-methyl-2,3-dihydro-1H-inden-1-one |
| 5,6-Dimethoxy-2-methyl-indan-1-one |
| 5,6-Dimethoxy-2-methyl-1-indanone |
| 5,6-Dimethoxy-2-methylindan-1-one |
| 5,6-dimethoxy-2-methyl-2,3-dihydroinden-1-one |