N-(tert-butoxycarbonyl)-3-phenyl-L-alanine, compound with dicyclohexylamine (1:1) structure
|
Common Name | N-(tert-butoxycarbonyl)-3-phenyl-L-alanine, compound with dicyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 4192-12-5 | Molecular Weight | 446.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H42N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dicyclohexylammonium Boc-L-phenylalaninate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H42N2O4 |
|---|---|
| Molecular Weight | 446.62300 |
| Exact Mass | 446.31400 |
| PSA | 87.66000 |
| LogP | 6.23020 |
| InChIKey | JMICVVJOIDXBJR-MERQFXBCSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-phenylalanine dicyclohexylamine salt |
| Boc-Phe-OH*DCHA |
| dicyclohexylammonium N-(tert-butoxycarbonyl)-L-phenylalaninate |